C22H34N4O7 — CID 162773312
2-[(9S)-9-[(4-aminophenyl)methyl]-7,11-bis(carboxymethyl)-1-oxa-4,7,11-triazacyclotridec-4-yl]acetic acid (PubChem CID 162773312) has the molecular formula C22H34N4O7 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[(9S)-9-[(4-aminophenyl)methyl]-7,11-bis(carboxymethyl)-1-oxa-4,7,11-triazacyclotridec-4-yl]acetic acid.
| Compound Name | 2-[(9S)-9-[(4-aminophenyl)methyl]-7,11-bis(carboxymethyl)-1-oxa-4,7,11-triazacyclotridec-4-yl]acetic acid |
|---|---|
| PubChem CID | 162773312 |
| Molecular Formula | C22H34N4O7 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[(9S)-9-[(4-aminophenyl)methyl]-7,11-bis(carboxymethyl)-1-oxa-4,7,11-triazacyclotridec-4-yl]acetic acid |
| SMILES | Nc1ccc(C[C@@H]2CN(CC(=O)O)CCOCCN(CC(=O)O)CCN(CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C22H34N4O7/c23-19-3-1-17(2-4-19)11-18-12-25(15-21(29)30)6-5-24(14-20(27)28)7-9-33-10-8-26(13-18)16-22(31)32/h1-4,18H,5-16,23H2,(H,27,28)(H,29,30)(H,31,32)/t18-/m0/s1 |
| InChIKey | MFWBQDSWTYMERV-SFHVURJKSA-N |
| XLogP | -0.38 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|