C24H35N5O4S — CID 101359922
2-[11-(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]acetic acid (PubChem CID 101359922) has the molecular formula C24H35N5O4S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-[11-(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]acetic acid.
| Compound Name | 2-[11-(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 101359922 |
| Molecular Formula | C24H35N5O4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[11-(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.2]hexadecan-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN2CCN(CC1)CC(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)CC2 |
| InChI | InChI=1S/C24H35N5O4S/c30-23(31)17-27-7-1-6-26-8-10-28(12-11-27)15-21(16-29(13-9-26)18-24(32)33)14-20-2-4-22(5-3-20)25-19-34/h2-5,21H,1,6-18H2,(H,30,31)(H,32,33) |
| InChIKey | UBTGQSONXHSDOD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|