C25H37N5O6S — CID 164792775
2-[4,8-bis(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-11-methyl-1,4,8,11-tetrazacyclotetradec-2-yl]acetic acid (PubChem CID 164792775) has the molecular formula C25H37N5O6S and a molecular weight of 535.67 g/mol. Its IUPAC name is 2-[4,8-bis(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-11-methyl-1,4,8,11-tetrazacyclotetradec-2-yl]acetic acid.
| Compound Name | 2-[4,8-bis(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-11-methyl-1,4,8,11-tetrazacyclotetradec-2-yl]acetic acid |
|---|---|
| PubChem CID | 164792775 |
| Molecular Formula | C25H37N5O6S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2-[4,8-bis(carboxymethyl)-13-[(4-isothiocyanatophenyl)methyl]-11-methyl-1,4,8,11-tetrazacyclotetradec-2-yl]acetic acid |
| SMILES | CN1CCN(CC(=O)O)CCCN(CC(=O)O)CC(CC(=O)O)NCC(Cc2ccc(N=C=S)cc2)C1 |
| InChI | InChI=1S/C25H37N5O6S/c1-28-9-10-29(16-24(33)34)7-2-8-30(17-25(35)36)15-22(12-23(31)32)26-13-20(14-28)11-19-3-5-21(6-4-19)27-18-37/h3-6,20,22,26H,2,7-17H2,1H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | VOMVZPNLICUZIQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|