C27H40BN5O9 — CID 171639897
CID 171639897 (PubChem CID 171639897) has the molecular formula C27H40BN5O9 and a molecular weight of 589.46 g/mol.
| Compound Name | CID 171639897 |
|---|---|
| PubChem CID | 171639897 |
| Molecular Formula | C27H40BN5O9 |
| Molecular Weight | 589.46 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CCN(CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C27H40BN5O9/c28-13-23(34)29-22-4-2-20(3-5-22)12-21-14-32(18-26(39)40)10-8-30(16-24(35)36)6-1-7-31(17-25(37)38)9-11-33(15-21)19-27(41)42/h2-5,21H,1,6-19H2,(H,29,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | VCORCAJNHWGSGB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 191.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.46 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|