C30H40N6O11 — CID 102297961
2-[4,7,10-tris(carboxymethyl)-6-[[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 102297961) has the molecular formula C30H40N6O11 and a molecular weight of 660.68 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-6-[[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-6-[[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 102297961 |
| Molecular Formula | C30H40N6O11 |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-6-[[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)C(Cc2ccc(NC(=O)CCN3C(=O)C=CC3=O)cc2)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C30H40N6O11/c37-24(7-8-36-25(38)5-6-26(36)39)31-22-3-1-21(2-4-22)15-23-16-34(19-29(44)45)12-11-32(17-27(40)41)9-10-33(18-28(42)43)13-14-35(23)20-30(46)47/h1-6,23H,7-20H2,(H,31,37)(H,40,41)(H,42,43)(H,44,45)(H,46,47) |
| InChIKey | GRXRLXJBZGKTHD-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 228.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|