C25H39N5O8S — CID 142509224
2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-6-[[4-(ethanethioylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 142509224) has the molecular formula C25H39N5O8S and a molecular weight of 569.68 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-6-[[4-(ethanethioylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-6-[[4-(ethanethioylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 142509224 |
| Molecular Formula | C25H39N5O8S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-6-[[4-(ethanethioylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(=S)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN2CC(O)O)cc1 |
| InChI | InChI=1S/C25H39N5O8S/c1-18(39)26-20-4-2-19(3-5-20)12-21-13-29(16-24(35)36)9-8-27(14-22(31)32)6-7-28(15-23(33)34)10-11-30(21)17-25(37)38/h2-5,21,25,37-38H,6-17H2,1H3,(H,26,39)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | UUOKKVBCSNOBME-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 177.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|