C20H32N4O2S — CID 142877914
2-[8-[[4-(ethanethioylamino)phenyl]methyl]-4-ethyl-1,4,7-triazecan-1-yl]acetic acid (PubChem CID 142877914) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[8-[[4-(ethanethioylamino)phenyl]methyl]-4-ethyl-1,4,7-triazecan-1-yl]acetic acid.
| Compound Name | 2-[8-[[4-(ethanethioylamino)phenyl]methyl]-4-ethyl-1,4,7-triazecan-1-yl]acetic acid |
|---|---|
| PubChem CID | 142877914 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[8-[[4-(ethanethioylamino)phenyl]methyl]-4-ethyl-1,4,7-triazecan-1-yl]acetic acid |
| SMILES | CCN1CCNC(Cc2ccc(NC(C)=S)cc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H32N4O2S/c1-3-23-11-9-21-19(8-10-24(13-12-23)15-20(25)26)14-17-4-6-18(7-5-17)22-16(2)27/h4-7,19,21H,3,8-15H2,1-2H3,(H,22,27)(H,25,26) |
| InChIKey | IJJLMNWVNDCHIS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|