C24H41N11O4S — CID 167249273
2-[6-[[4-(aminocarbamothioylamino)phenyl]methyl]-4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 167249273) has the molecular formula C24H41N11O4S and a molecular weight of 579.73 g/mol. Its IUPAC name is 2-[6-[[4-(aminocarbamothioylamino)phenyl]methyl]-4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | 2-[6-[[4-(aminocarbamothioylamino)phenyl]methyl]-4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 167249273 |
| Molecular Formula | C24H41N11O4S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 2-[6-[[4-(aminocarbamothioylamino)phenyl]methyl]-4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | NNC(=S)Nc1ccc(CC2CN(CC(N)=O)CCN(CC(N)=O)CCN(CC(N)=O)CCN2CC(N)=O)cc1 |
| InChI | InChI=1S/C24H41N11O4S/c25-20(36)13-32-5-6-33(14-21(26)37)9-10-35(16-23(28)39)19(12-34(8-7-32)15-22(27)38)11-17-1-3-18(4-2-17)30-24(40)31-29/h1-4,19H,5-16,29H2,(H2,25,36)(H2,26,37)(H2,27,38)(H2,28,39)(H2,30,31,40) |
| InChIKey | MIQLRPOJVLPSSF-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 235.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|