C28H48N8O4 — CID 158494578
2-[4,7,10-tris(2-amino-2-oxoethyl)-6-[[4-(2,2-dimethylpropyl)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 158494578) has the molecular formula C28H48N8O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is 2-[4,7,10-tris(2-amino-2-oxoethyl)-6-[[4-(2,2-dimethylpropyl)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | 2-[4,7,10-tris(2-amino-2-oxoethyl)-6-[[4-(2,2-dimethylpropyl)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 158494578 |
| Molecular Formula | C28H48N8O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | 2-[4,7,10-tris(2-amino-2-oxoethyl)-6-[[4-(2,2-dimethylpropyl)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | CC(C)(C)Cc1ccc(CC2CN(CC(N)=O)CCN(CC(N)=O)CCN(CC(N)=O)CCN2CC(N)=O)cc1 |
| InChI | InChI=1S/C28H48N8O4/c1-28(2,3)15-22-6-4-21(5-7-22)14-23-16-35(19-26(31)39)11-10-33(17-24(29)37)8-9-34(18-25(30)38)12-13-36(23)20-27(32)40/h4-7,23H,8-20H2,1-3H3,(H2,29,37)(H2,30,38)(H2,31,39)(H2,32,40) |
| InChIKey | YNBDYUXPXRZJMQ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 185.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |