C46H80N4O12 — CID 171065523
tert-butyl 2-[(6R)-6-[[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methyl]-4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 171065523) has the molecular formula C46H80N4O12 and a molecular weight of 881.16 g/mol. Its IUPAC name is tert-butyl 2-[(6R)-6-[[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methyl]-4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[(6R)-6-[[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methyl]-4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 171065523 |
| Molecular Formula | C46H80N4O12 |
| Molecular Weight | 881.16 g/mol |
| Exact Mass | 880.58 |
| IUPAC Name | tert-butyl 2-[(6R)-6-[[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methyl]-4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | COCCOCCOCCOc1ccc(C[C@@H]2CN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN2CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C46H80N4O12/c1-43(2,3)59-39(51)32-47-18-19-48(33-40(52)60-44(4,5)6)22-23-50(35-42(54)62-46(10,11)12)37(31-49(21-20-47)34-41(53)61-45(7,8)9)30-36-14-16-38(17-15-36)58-29-28-57-27-26-56-25-24-55-13/h14-17,37H,18-35H2,1-13H3/t37-/m1/s1 |
| InChIKey | USMQNZIJWKVTON-DIPNUNPCSA-N |
| XLogP | 4.24 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|