C41H71N5O8 — CID 122382577
tert-butyl 2-[6-[(4-aminophenyl)methyl]-4,8,11-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,8,11-tetrazacyclotetradec-1-yl]acetate (PubChem CID 122382577) has the molecular formula C41H71N5O8 and a molecular weight of 762.05 g/mol. Its IUPAC name is tert-butyl 2-[6-[(4-aminophenyl)methyl]-4,8,11-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,8,11-tetrazacyclotetradec-1-yl]acetate.
| Compound Name | tert-butyl 2-[6-[(4-aminophenyl)methyl]-4,8,11-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
|---|---|
| PubChem CID | 122382577 |
| Molecular Formula | C41H71N5O8 |
| Molecular Weight | 762.05 g/mol |
| Exact Mass | 761.53 |
| IUPAC Name | tert-butyl 2-[6-[(4-aminophenyl)methyl]-4,8,11-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC(Cc2ccc(N)cc2)CN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C41H71N5O8/c1-38(2,3)51-34(47)27-43-18-13-19-44(28-35(48)52-39(4,5)6)21-23-46(30-37(50)54-41(10,11)12)26-32(24-31-14-16-33(42)17-15-31)25-45(22-20-43)29-36(49)53-40(7,8)9/h14-17,32H,13,18-30,42H2,1-12H3 |
| InChIKey | FQOAACUUBPYKDS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|