C18H28N4O3 — CID 118429293
tert-butyl 2-[4-[(5-amino-2-carbamoylphenyl)methyl]piperazin-1-yl]acetate (PubChem CID 118429293) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl 2-[4-[(5-amino-2-carbamoylphenyl)methyl]piperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[(5-amino-2-carbamoylphenyl)methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 118429293 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | tert-butyl 2-[4-[(5-amino-2-carbamoylphenyl)methyl]piperazin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(Cc2cc(N)ccc2C(N)=O)CC1 |
| InChI | InChI=1S/C18H28N4O3/c1-18(2,3)25-16(23)12-22-8-6-21(7-9-22)11-13-10-14(19)4-5-15(13)17(20)24/h4-5,10H,6-9,11-12,19H2,1-3H3,(H2,20,24) |
| InChIKey | PIPCIAUVRUFMQO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|