C19H30N4O3 — CID 118428040
tert-butyl 2-[4-[[5-amino-2-(methylcarbamoyl)phenyl]methyl]piperazin-1-yl]acetate (PubChem CID 118428040) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-amino-2-(methylcarbamoyl)phenyl]methyl]piperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[[5-amino-2-(methylcarbamoyl)phenyl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 118428040 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | tert-butyl 2-[4-[[5-amino-2-(methylcarbamoyl)phenyl]methyl]piperazin-1-yl]acetate |
| SMILES | CNC(=O)c1ccc(N)cc1CN1CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H30N4O3/c1-19(2,3)26-17(24)13-23-9-7-22(8-10-23)12-14-11-15(20)5-6-16(14)18(25)21-4/h5-6,11H,7-10,12-13,20H2,1-4H3,(H,21,25) |
| InChIKey | QZZYQZBINSEPMU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|