C20H29N3O4 — CID 177221369
2-[3-[(4-methylphenyl)methyl]-4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 177221369) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methyl]-4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[3-[(4-methylphenyl)methyl]-4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 177221369 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methyl]-4,7-bis(2-oxoethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | Cc1ccc(CC2CN(CC(=O)O)CCN(CC=O)CCN2CC=O)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-17-2-4-18(5-3-17)14-19-15-22(16-20(26)27)7-6-21(10-12-24)8-9-23(19)11-13-25/h2-5,12-13,19H,6-11,14-16H2,1H3,(H,26,27) |
| InChIKey | ODRBCFAEPQCQLL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|