C24H33N5O8S — CID 87161216
2-[(7S)-1,4,10-tris(carboxymethyl)-2-[(4-isothiocyanatophenyl)methyl]-1,2,3,4-tetrazacyclododec-7-yl]acetic acid (PubChem CID 87161216) has the molecular formula C24H33N5O8S and a molecular weight of 551.62 g/mol. Its IUPAC name is 2-[(7S)-1,4,10-tris(carboxymethyl)-2-[(4-isothiocyanatophenyl)methyl]-1,2,3,4-tetrazacyclododec-7-yl]acetic acid.
| Compound Name | 2-[(7S)-1,4,10-tris(carboxymethyl)-2-[(4-isothiocyanatophenyl)methyl]-1,2,3,4-tetrazacyclododec-7-yl]acetic acid |
|---|---|
| PubChem CID | 87161216 |
| Molecular Formula | C24H33N5O8S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-[(7S)-1,4,10-tris(carboxymethyl)-2-[(4-isothiocyanatophenyl)methyl]-1,2,3,4-tetrazacyclododec-7-yl]acetic acid |
| SMILES | O=C(O)CC1CC[C@H](CC(=O)O)CCN(CC(=O)O)NN(Cc2ccc(N=C=S)cc2)N(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H33N5O8S/c30-21(31)11-17-1-2-18(12-22(32)33)8-10-28(15-24(36)37)29(26-27(9-7-17)14-23(34)35)13-19-3-5-20(6-4-19)25-16-38/h3-6,17-18,26H,1-2,7-15H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)/t17-,18?/m0/s1 |
| InChIKey | PKFVKSQNYSMTPW-ZENAZSQFSA-N |
| XLogP | 2.09 |
| TPSA | 183.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|