C23H33N5O6S — CID 58455043
2-[4,7-bis(carboxymethyl)-10-[[4-(2-sulfanylideneethylideneamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 58455043) has the molecular formula C23H33N5O6S and a molecular weight of 507.61 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[[4-(2-sulfanylideneethylideneamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[[4-(2-sulfanylideneethylideneamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 58455043 |
| Molecular Formula | C23H33N5O6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[[4-(2-sulfanylideneethylideneamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2ccc(/N=C/C=S)cc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C23H33N5O6S/c29-21(30)16-26-8-6-25(15-19-1-3-20(4-2-19)24-5-14-35)7-9-27(17-22(31)32)11-13-28(12-10-26)18-23(33)34/h1-5,14H,6-13,15-18H2,(H,29,30)(H,31,32)(H,33,34)/b24-5+ |
| InChIKey | BLNWDQOMVXPETD-ZXKDJJQISA-N |
| XLogP | 0.36 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|