C22H32N4O6 — CID 163439340
(Z)-3-[7-benzyl-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]prop-2-enoic acid (PubChem CID 163439340) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is (Z)-3-[7-benzyl-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-[7-benzyl-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163439340 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (Z)-3-[7-benzyl-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C\N1CCN(CC(=O)O)CCN(Cc2ccccc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H32N4O6/c27-20(28)6-7-23-8-10-25(17-21(29)30)14-12-24(16-19-4-2-1-3-5-19)13-15-26(11-9-23)18-22(31)32/h1-7H,8-18H2,(H,27,28)(H,29,30)(H,31,32)/b7-6- |
| InChIKey | AXEJOOJXDBGOOV-SREVYHEPSA-N |
| XLogP | 0.18 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|