C24H37N5O6 — CID 88869664
2-[11-(formyloxymethyl)-16-[(4-nitrophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid (PubChem CID 88869664) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[11-(formyloxymethyl)-16-[(4-nitrophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid.
| Compound Name | 2-[11-(formyloxymethyl)-16-[(4-nitrophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 88869664 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-[11-(formyloxymethyl)-16-[(4-nitrophenyl)methyl]-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid |
| SMILES | O=COCN1CCCN2CCN(CC(=O)O)CCCN(CC1)CC(Cc1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C24H37N5O6/c30-20-35-19-28-10-2-8-25-11-12-27(18-24(31)32)9-1-7-26(13-14-28)17-22(16-25)15-21-3-5-23(6-4-21)29(33)34/h3-6,20,22H,1-2,7-19H2,(H,31,32) |
| InChIKey | JPAMODWRHRLRJA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|