C24H36N6O9 — CID 139614493
2-[4,7-bis(carboxymethyl)-6-[2-(4-nitrophenyl)ethylamino]-6-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 139614493) has the molecular formula C24H36N6O9 and a molecular weight of 552.59 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-6-[2-(4-nitrophenyl)ethylamino]-6-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-6-[2-(4-nitrophenyl)ethylamino]-6-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 139614493 |
| Molecular Formula | C24H36N6O9 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-6-[2-(4-nitrophenyl)ethylamino]-6-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=CCC1(NCCc2ccc([N+](=O)[O-])cc2)CN(CC(=O)O)CCN(CC(=O)O)CCNCCN1CC(=O)O |
| InChI | InChI=1S/C24H36N6O9/c31-14-6-24(26-7-5-19-1-3-20(4-2-19)30(38)39)18-28(16-22(34)35)13-12-27(15-21(32)33)10-8-25-9-11-29(24)17-23(36)37/h1-4,14,25-26H,5-13,15-18H2,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | XEGJVAGNFYZEQN-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 205.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|