C19H29N5O7 — CID 138673497
2-[7-(carboxymethyl)-4-[(2-hydroxy-5-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 138673497) has the molecular formula C19H29N5O7 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[7-(carboxymethyl)-4-[(2-hydroxy-5-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-(carboxymethyl)-4-[(2-hydroxy-5-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 138673497 |
| Molecular Formula | C19H29N5O7 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[7-(carboxymethyl)-4-[(2-hydroxy-5-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCNCCN(CC(=O)O)CCN(Cc2cc([N+](=O)[O-])ccc2O)CC1 |
| InChI | InChI=1S/C19H29N5O7/c25-17-2-1-16(24(30)31)11-15(17)12-23-9-7-21(13-18(26)27)5-3-20-4-6-22(8-10-23)14-19(28)29/h1-2,11,20,25H,3-10,12-14H2,(H,26,27)(H,28,29) |
| InChIKey | VXHDHGOOTOCMLP-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|