C25H26N4O7 — CID 177404429
8-[(2-hydroxy-5-nitrophenyl)methyl]-2,14-dioxa-5,8,11-triazatricyclo[13.8.0.017,22]tricosa-1(23),15,17,19,21-pentaene-4,12-dione (PubChem CID 177404429) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 8-[(2-hydroxy-5-nitrophenyl)methyl]-2,14-dioxa-5,8,11-triazatricyclo[13.8.0.017,22]tricosa-1(23),15,17,19,21-pentaene-4,12-dione.
| Compound Name | 8-[(2-hydroxy-5-nitrophenyl)methyl]-2,14-dioxa-5,8,11-triazatricyclo[13.8.0.017,22]tricosa-1(23),15,17,19,21-pentaene-4,12-dione |
|---|---|
| PubChem CID | 177404429 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 8-[(2-hydroxy-5-nitrophenyl)methyl]-2,14-dioxa-5,8,11-triazatricyclo[13.8.0.017,22]tricosa-1(23),15,17,19,21-pentaene-4,12-dione |
| SMILES | O=C1COc2cc3ccccc3cc2OCC(=O)NCCN(Cc2cc([N+](=O)[O-])ccc2O)CCN1 |
| InChI | InChI=1S/C25H26N4O7/c30-21-6-5-20(29(33)34)11-19(21)14-28-9-7-26-24(31)15-35-22-12-17-3-1-2-4-18(17)13-23(22)36-16-25(32)27-8-10-28/h1-6,11-13,30H,7-10,14-16H2,(H,26,31)(H,27,32) |
| InChIKey | ZPVIAWXLILGFPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|