C25H40N4O8 — CID 118175497
2-[16-[3-(2,5-dioxocyclopentyl)oxy-3-oxopropyl]-11-(formyloxymethyl)-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid (PubChem CID 118175497) has the molecular formula C25H40N4O8 and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-[16-[3-(2,5-dioxocyclopentyl)oxy-3-oxopropyl]-11-(formyloxymethyl)-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid.
| Compound Name | 2-[16-[3-(2,5-dioxocyclopentyl)oxy-3-oxopropyl]-11-(formyloxymethyl)-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 118175497 |
| Molecular Formula | C25H40N4O8 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2-[16-[3-(2,5-dioxocyclopentyl)oxy-3-oxopropyl]-11-(formyloxymethyl)-1,4,8,11-tetrazabicyclo[6.6.3]heptadecan-4-yl]acetic acid |
| SMILES | O=COCN1CCCN2CCN(CC(=O)O)CCCN(CC1)CC(CCC(=O)OC1C(=O)CCC1=O)C2 |
| InChI | InChI=1S/C25H40N4O8/c30-19-36-18-29-10-2-8-26-11-12-28(17-23(33)34)9-1-7-27(13-14-29)16-20(15-26)3-6-24(35)37-25-21(31)4-5-22(25)32/h19-20,25H,1-18H2,(H,33,34) |
| InChIKey | VZZYMGKRWMFPET-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|