C14H18ClNO3 — CID 102604213
2-[6-[(4-chlorophenyl)methyl]-1,4-oxazepan-4-yl]acetic acid (PubChem CID 102604213) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 2-[6-[(4-chlorophenyl)methyl]-1,4-oxazepan-4-yl]acetic acid.
| Compound Name | 2-[6-[(4-chlorophenyl)methyl]-1,4-oxazepan-4-yl]acetic acid |
|---|---|
| PubChem CID | 102604213 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[6-[(4-chlorophenyl)methyl]-1,4-oxazepan-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCOCC(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H18ClNO3/c15-13-3-1-11(2-4-13)7-12-8-16(9-14(17)18)5-6-19-10-12/h1-4,12H,5-10H2,(H,17,18) |
| InChIKey | ZQGPLEAVTFYLTI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |