2-(6-methyl-1,4-oxazepan-4-yl)acetic acid

C8H15NO3 — CID 131059180

IUPAC2-(6-methyl-1,4-oxazepan-4-yl)acetic acid
SMILESCC1COCCN(CC(=O)O)C1
InChIInChI=1S/C8H15NO3/c1-7-4-9(5-8(10)11)2-3-12-6-7/h7H,2-6H2,1H3,(H,10,11)
InChIKeyCLZRMCPAFYUQEP-UHFFFAOYSA-N
MW173.21 g/mol
LogP0.04
Rot. Bonds2

About 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid

2-(6-methyl-1,4-oxazepan-4-yl)acetic acid (PubChem CID 131059180) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid.

Molecular Properties

Compound Name2-(6-methyl-1,4-oxazepan-4-yl)acetic acid
PubChem CID131059180
Molecular FormulaC8H15NO3
Molecular Weight173.21 g/mol
Exact Mass173.11
IUPAC Name2-(6-methyl-1,4-oxazepan-4-yl)acetic acid
SMILESCC1COCCN(CC(=O)O)C1
InChIInChI=1S/C8H15NO3/c1-7-4-9(5-8(10)11)2-3-12-6-7/h7H,2-6H2,1H3,(H,10,11)
InChIKeyCLZRMCPAFYUQEP-UHFFFAOYSA-N
XLogP0.04
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.21
LogP ≤ 50.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid?
The IUPAC name of 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid (CID 131059180) is 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid.
What is the SMILES notation for 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid?
The canonical SMILES for 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid is CC1COCCN(CC(=O)O)C1.
What is the InChIKey of 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid?
The InChIKey is CLZRMCPAFYUQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-7-4-9(5-8(10)11)2-3-12-6-7/h7H,2-6H2,1H3,(H,10,11).
What are the key properties of 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid?
2-(6-methyl-1,4-oxazepan-4-yl)acetic acid has a molecular weight of 173.21 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-1,4-oxazepan-4-yl)acetic acid is sourced from PubChem (CID 131059180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).