C9H18ClNO2 — CID 130927583
1-chloro-3-(6-methyl-1,4-oxazepan-4-yl)propan-2-ol (PubChem CID 130927583) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is 1-chloro-3-(6-methyl-1,4-oxazepan-4-yl)propan-2-ol.
| Compound Name | 1-chloro-3-(6-methyl-1,4-oxazepan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 130927583 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-chloro-3-(6-methyl-1,4-oxazepan-4-yl)propan-2-ol |
| SMILES | CC1COCCN(CC(O)CCl)C1 |
| InChI | InChI=1S/C9H18ClNO2/c1-8-5-11(2-3-13-7-8)6-9(12)4-10/h8-9,12H,2-7H2,1H3 |
| InChIKey | SRNXAJQEUFFCLR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|