C9H17NO3 — CID 130942762
1-(6-hydroxy-1,4-oxazepan-4-yl)butan-2-one (PubChem CID 130942762) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(6-hydroxy-1,4-oxazepan-4-yl)butan-2-one.
| Compound Name | 1-(6-hydroxy-1,4-oxazepan-4-yl)butan-2-one |
|---|---|
| PubChem CID | 130942762 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-(6-hydroxy-1,4-oxazepan-4-yl)butan-2-one |
| SMILES | CCC(=O)CN1CCOCC(O)C1 |
| InChI | InChI=1S/C9H17NO3/c1-2-8(11)5-10-3-4-13-7-9(12)6-10/h9,12H,2-7H2,1H3 |
| InChIKey | QKTWVTGNYQXAOH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |