C8H13NO2 — CID 130961392
4-prop-2-ynyl-1,4-oxazepan-6-ol (PubChem CID 130961392) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-prop-2-ynyl-1,4-oxazepan-6-ol.
| Compound Name | 4-prop-2-ynyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 130961392 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-prop-2-ynyl-1,4-oxazepan-6-ol |
| SMILES | C#CCN1CCOCC(O)C1 |
| InChI | InChI=1S/C8H13NO2/c1-2-3-9-4-5-11-7-8(10)6-9/h1,8,10H,3-7H2 |
| InChIKey | YMLYTRJBOZHINS-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|