C18H30N2O4 — CID 101268758
3,12-bis(prop-2-ynyl)-1,6,9,15-tetraoxa-3,12-diazacyclooctadecane (PubChem CID 101268758) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3,12-bis(prop-2-ynyl)-1,6,9,15-tetraoxa-3,12-diazacyclooctadecane.
| Compound Name | 3,12-bis(prop-2-ynyl)-1,6,9,15-tetraoxa-3,12-diazacyclooctadecane |
|---|---|
| PubChem CID | 101268758 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3,12-bis(prop-2-ynyl)-1,6,9,15-tetraoxa-3,12-diazacyclooctadecane |
| SMILES | C#CCN1CCOCCCOCN(CC#C)CCOCCOCC1 |
| InChI | InChI=1S/C18H30N2O4/c1-3-6-19-8-13-21-11-5-12-24-18-20(7-4-2)10-15-23-17-16-22-14-9-19/h1-2H,5-18H2 |
| InChIKey | MQALTDUPJDJPOD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|