About oxalic acid;1-prop-2-ynylpiperidine
oxalic acid;1-prop-2-ynylpiperidine (PubChem CID 71318911) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is oxalic acid;1-prop-2-ynylpiperidine.
Molecular Properties
| Compound Name | oxalic acid;1-prop-2-ynylpiperidine |
| PubChem CID | 71318911 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | oxalic acid;1-prop-2-ynylpiperidine |
| SMILES | C#CCN1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H13N.C2H2O4/c1-2-6-9-7-4-3-5-8-9;3-1(4)2(5)6/h1H,3-8H2;(H,3,4)(H,5,6) |
| InChIKey | VJSMXZYRRBDQRB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;1-prop-2-ynylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;1-prop-2-ynylpiperidine?
The IUPAC name of oxalic acid;1-prop-2-ynylpiperidine (CID 71318911) is oxalic acid;1-prop-2-ynylpiperidine.
What is the SMILES notation for oxalic acid;1-prop-2-ynylpiperidine?
The canonical SMILES for oxalic acid;1-prop-2-ynylpiperidine is C#CCN1CCCCC1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;1-prop-2-ynylpiperidine?
The InChIKey is VJSMXZYRRBDQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C2H2O4/c1-2-6-9-7-4-3-5-8-9;3-1(4)2(5)6/h1H,3-8H2;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;1-prop-2-ynylpiperidine?
oxalic acid;1-prop-2-ynylpiperidine has a molecular weight of 213.23 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;1-prop-2-ynylpiperidine is sourced from PubChem (CID 71318911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).