C9H18N2O2 — CID 6454623
3-(1,3-oxazinan-3-ylmethyl)-1,3-oxazinane (PubChem CID 6454623) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(1,3-oxazinan-3-ylmethyl)-1,3-oxazinane.
| Compound Name | 3-(1,3-oxazinan-3-ylmethyl)-1,3-oxazinane |
|---|---|
| PubChem CID | 6454623 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-(1,3-oxazinan-3-ylmethyl)-1,3-oxazinane |
| SMILES | C1COCN(CN2CCCOC2)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-3-10(8-12-5-1)7-11-4-2-6-13-9-11/h1-9H2 |
| InChIKey | GJBKLYJVZOTRSP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |