C11H20N2O — CID 138728331
N,N-dimethyl-2-[(2S)-4-prop-2-ynylmorpholin-2-yl]ethanamine (PubChem CID 138728331) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2S)-4-prop-2-ynylmorpholin-2-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[(2S)-4-prop-2-ynylmorpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 138728331 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N,N-dimethyl-2-[(2S)-4-prop-2-ynylmorpholin-2-yl]ethanamine |
| SMILES | C#CCN1CCO[C@@H](CCN(C)C)C1 |
| InChI | InChI=1S/C11H20N2O/c1-4-6-13-8-9-14-11(10-13)5-7-12(2)3/h1,11H,5-10H2,2-3H3/t11-/m0/s1 |
| InChIKey | HBISITAGNHSHMZ-NSHDSACASA-N |
| XLogP | 0.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|