C16H34N2OS — CID 170115847
1-[methyl-[2-[(2R)-4-(4-methylpentyl)morpholin-2-yl]ethyl]amino]propane-2-thiol (PubChem CID 170115847) has the molecular formula C16H34N2OS and a molecular weight of 302.53 g/mol. Its IUPAC name is 1-[methyl-[2-[(2R)-4-(4-methylpentyl)morpholin-2-yl]ethyl]amino]propane-2-thiol.
| Compound Name | 1-[methyl-[2-[(2R)-4-(4-methylpentyl)morpholin-2-yl]ethyl]amino]propane-2-thiol |
|---|---|
| PubChem CID | 170115847 |
| Molecular Formula | C16H34N2OS |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[methyl-[2-[(2R)-4-(4-methylpentyl)morpholin-2-yl]ethyl]amino]propane-2-thiol |
| SMILES | CC(C)CCCN1CCO[C@H](CCN(C)CC(C)S)C1 |
| InChI | InChI=1S/C16H34N2OS/c1-14(2)6-5-8-18-10-11-19-16(13-18)7-9-17(4)12-15(3)20/h14-16,20H,5-13H2,1-4H3/t15?,16-/m1/s1 |
| InChIKey | OZJIYGMPOAOAQF-OEMAIJDKSA-N |
| XLogP | 2.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|