C16H33NO — CID 149421762
(2R)-2,4-bis(4-methylpentyl)morpholine (PubChem CID 149421762) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (2R)-2,4-bis(4-methylpentyl)morpholine.
| Compound Name | (2R)-2,4-bis(4-methylpentyl)morpholine |
|---|---|
| PubChem CID | 149421762 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (2R)-2,4-bis(4-methylpentyl)morpholine |
| SMILES | CC(C)CCC[C@@H]1CN(CCCC(C)C)CCO1 |
| InChI | InChI=1S/C16H33NO/c1-14(2)7-5-9-16-13-17(11-12-18-16)10-6-8-15(3)4/h14-16H,5-13H2,1-4H3/t16-/m1/s1 |
| InChIKey | YTHOYSUUIPPJRG-MRXNPFEDSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |