C10H21ClN2O — CID 114526695
3-[2-(chloromethyl)morpholin-4-yl]-N,N-dimethylpropan-1-amine (PubChem CID 114526695) has the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. Its IUPAC name is 3-[2-(chloromethyl)morpholin-4-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-(chloromethyl)morpholin-4-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114526695 |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-[2-(chloromethyl)morpholin-4-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1CCOC(CCl)C1 |
| InChI | InChI=1S/C10H21ClN2O/c1-12(2)4-3-5-13-6-7-14-10(8-11)9-13/h10H,3-9H2,1-2H3 |
| InChIKey | QVWITALCMOUTGE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|