C7H14N2O3 — CID 131062493
6-hydroxy-N-methyl-1,4-oxazepane-4-carboxamide (PubChem CID 131062493) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 6-hydroxy-N-methyl-1,4-oxazepane-4-carboxamide.
| Compound Name | 6-hydroxy-N-methyl-1,4-oxazepane-4-carboxamide |
|---|---|
| PubChem CID | 131062493 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 6-hydroxy-N-methyl-1,4-oxazepane-4-carboxamide |
| SMILES | CNC(=O)N1CCOCC(O)C1 |
| InChI | InChI=1S/C7H14N2O3/c1-8-7(11)9-2-3-12-5-6(10)4-9/h6,10H,2-5H2,1H3,(H,8,11) |
| InChIKey | CNLRYEMDRBGTST-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |