About 6-(methylamino)-1,4-oxazepane-4-carboxylic acid
6-(methylamino)-1,4-oxazepane-4-carboxylic acid (PubChem CID 67518083) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is 6-(methylamino)-1,4-oxazepane-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-(methylamino)-1,4-oxazepane-4-carboxylic acid |
| PubChem CID | 67518083 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 6-(methylamino)-1,4-oxazepane-4-carboxylic acid |
| SMILES | CNC1COCCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H14N2O3/c1-8-6-4-9(7(10)11)2-3-12-5-6/h6,8H,2-5H2,1H3,(H,10,11) |
| InChIKey | LVAQYYQNUTUZJL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(methylamino)-1,4-oxazepane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-1,4-oxazepane-4-carboxylic acid?
The IUPAC name of 6-(methylamino)-1,4-oxazepane-4-carboxylic acid (CID 67518083) is 6-(methylamino)-1,4-oxazepane-4-carboxylic acid.
What is the SMILES notation for 6-(methylamino)-1,4-oxazepane-4-carboxylic acid?
The canonical SMILES for 6-(methylamino)-1,4-oxazepane-4-carboxylic acid is CNC1COCCN(C(=O)O)C1.
What is the InChIKey of 6-(methylamino)-1,4-oxazepane-4-carboxylic acid?
The InChIKey is LVAQYYQNUTUZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3/c1-8-6-4-9(7(10)11)2-3-12-5-6/h6,8H,2-5H2,1H3,(H,10,11).
What are the key properties of 6-(methylamino)-1,4-oxazepane-4-carboxylic acid?
6-(methylamino)-1,4-oxazepane-4-carboxylic acid has a molecular weight of 174.20 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-1,4-oxazepane-4-carboxylic acid is sourced from PubChem (CID 67518083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).