C6H12N2O4 — CID 90220300
6-aminooxy-1,4-oxazepane-4-carboxylic acid (PubChem CID 90220300) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 6-aminooxy-1,4-oxazepane-4-carboxylic acid.
| Compound Name | 6-aminooxy-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 90220300 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 6-aminooxy-1,4-oxazepane-4-carboxylic acid |
| SMILES | NOC1COCCN(C(=O)O)C1 |
| InChI | InChI=1S/C6H12N2O4/c7-12-5-3-8(6(9)10)1-2-11-4-5/h5H,1-4,7H2,(H,9,10) |
| InChIKey | JDQULJPANQEIGR-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|