C17H23NO4 — CID 75411596
oxan-4-yl-[(6R)-6-phenoxy-1,4-oxazepan-4-yl]methanone (PubChem CID 75411596) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is oxan-4-yl-[(6R)-6-phenoxy-1,4-oxazepan-4-yl]methanone.
| Compound Name | oxan-4-yl-[(6R)-6-phenoxy-1,4-oxazepan-4-yl]methanone |
|---|---|
| PubChem CID | 75411596 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | oxan-4-yl-[(6R)-6-phenoxy-1,4-oxazepan-4-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CCOC[C@H](Oc2ccccc2)C1 |
| InChI | InChI=1S/C17H23NO4/c19-17(14-6-9-20-10-7-14)18-8-11-21-13-16(12-18)22-15-4-2-1-3-5-15/h1-5,14,16H,6-13H2/t16-/m1/s1 |
| InChIKey | XQMJVFFILFYGQM-MRXNPFEDSA-N |
| XLogP | 1.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |