C16H21NO3 — CID 96578519
[3-(3-ethylphenoxy)azetidin-1-yl]-[(3S)-oxolan-3-yl]methanone (PubChem CID 96578519) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [3-(3-ethylphenoxy)azetidin-1-yl]-[(3S)-oxolan-3-yl]methanone.
| Compound Name | [3-(3-ethylphenoxy)azetidin-1-yl]-[(3S)-oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 96578519 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [3-(3-ethylphenoxy)azetidin-1-yl]-[(3S)-oxolan-3-yl]methanone |
| SMILES | CCc1cccc(OC2CN(C(=O)[C@H]3CCOC3)C2)c1 |
| InChI | InChI=1S/C16H21NO3/c1-2-12-4-3-5-14(8-12)20-15-9-17(10-15)16(18)13-6-7-19-11-13/h3-5,8,13,15H,2,6-7,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | VRLZQESQSYEEOP-ZDUSSCGKSA-N |
| XLogP | 1.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |