C22H40N2O9 — CID 159511906
tert-butyl 6-acetyloxy-1,4-oxazepane-4-carboxylate;tert-butyl 6-hydroxy-1,4-oxazepane-4-carboxylate (PubChem CID 159511906) has the molecular formula C22H40N2O9 and a molecular weight of 476.57 g/mol. Its IUPAC name is tert-butyl 6-acetyloxy-1,4-oxazepane-4-carboxylate;tert-butyl 6-hydroxy-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 6-acetyloxy-1,4-oxazepane-4-carboxylate;tert-butyl 6-hydroxy-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 159511906 |
| Molecular Formula | C22H40N2O9 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | tert-butyl 6-acetyloxy-1,4-oxazepane-4-carboxylate;tert-butyl 6-hydroxy-1,4-oxazepane-4-carboxylate |
| SMILES | CC(=O)OC1COCCN(C(=O)OC(C)(C)C)C1.CC(C)(C)OC(=O)N1CCOCC(O)C1 |
| InChI | InChI=1S/C12H21NO5.C10H19NO4/c1-9(14)17-10-7-13(5-6-16-8-10)11(15)18-12(2,3)4;1-10(2,3)15-9(13)11-4-5-14-7-8(12)6-11/h10H,5-8H2,1-4H3;8,12H,4-7H2,1-3H3 |
| InChIKey | MASAGSNRWVVCEQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|