C10H17FN2O3 — CID 135329024
(3S,4R)-3-fluoro-4-(oxolan-3-ylamino)piperidine-1-carboxylic acid (PubChem CID 135329024) has the molecular formula C10H17FN2O3 and a molecular weight of 232.25 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-4-(oxolan-3-ylamino)piperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-3-fluoro-4-(oxolan-3-ylamino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135329024 |
| Molecular Formula | C10H17FN2O3 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3S,4R)-3-fluoro-4-(oxolan-3-ylamino)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H](NC2CCOC2)[C@@H](F)C1 |
| InChI | InChI=1S/C10H17FN2O3/c11-8-5-13(10(14)15)3-1-9(8)12-7-2-4-16-6-7/h7-9,12H,1-6H2,(H,14,15)/t7?,8-,9+/m0/s1 |
| InChIKey | JTGVZTMROZRUHY-SXNZSPLWSA-N |
| XLogP | 0.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |