C12H17F3N2O3 — CID 110868822
N-(oxolan-3-yl)-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide (PubChem CID 110868822) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is N-(oxolan-3-yl)-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide.
| Compound Name | N-(oxolan-3-yl)-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110868822 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(oxolan-3-yl)-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCOC1)C1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3N2O3/c13-12(14,15)11(19)17-4-1-8(2-5-17)10(18)16-9-3-6-20-7-9/h8-9H,1-7H2,(H,16,18) |
| InChIKey | SRVNUIWEZFBUTO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |