C13H19F3N2O3 — CID 110666960
N-cyclopentyloxy-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide (PubChem CID 110666960) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide.
| Compound Name | N-cyclopentyloxy-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110666960 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-cyclopentyloxy-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
| SMILES | O=C(NOC1CCCC1)C1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3N2O3/c14-13(15,16)12(20)18-7-5-9(6-8-18)11(19)17-21-10-3-1-2-4-10/h9-10H,1-8H2,(H,17,19) |
| InChIKey | OGNNLJCXTUTJIZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|