C11H16F3NO2 — CID 167250974
1-(3-cyclohexyloxyazetidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 167250974) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-(3-cyclohexyloxyazetidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-cyclohexyloxyazetidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 167250974 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(3-cyclohexyloxyazetidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CC(OC2CCCCC2)C1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2/c12-11(13,14)10(16)15-6-9(7-15)17-8-4-2-1-3-5-8/h8-9H,1-7H2 |
| InChIKey | VXGCNMJCWJPMLT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |