C13H14ClF3N2O2 — CID 76779368
1-[3-(2-amino-5-chlorophenoxy)piperidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 76779368) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is 1-[3-(2-amino-5-chlorophenoxy)piperidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-(2-amino-5-chlorophenoxy)piperidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 76779368 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-[3-(2-amino-5-chlorophenoxy)piperidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(Cl)cc1OC1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14ClF3N2O2/c14-8-3-4-10(18)11(6-8)21-9-2-1-5-19(7-9)12(20)13(15,16)17/h3-4,6,9H,1-2,5,7,18H2 |
| InChIKey | CAOWCUFYVLBJGQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|