C14H17F3N2O4 — CID 88903277
N-hydroxy-4-methyl-2-[(3S)-1-(2,2,2-trifluoroacetyl)piperidin-3-yl]oxybenzeneamine oxide (PubChem CID 88903277) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is N-hydroxy-4-methyl-2-[(3S)-1-(2,2,2-trifluoroacetyl)piperidin-3-yl]oxybenzeneamine oxide.
| Compound Name | N-hydroxy-4-methyl-2-[(3S)-1-(2,2,2-trifluoroacetyl)piperidin-3-yl]oxybenzeneamine oxide |
|---|---|
| PubChem CID | 88903277 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-hydroxy-4-methyl-2-[(3S)-1-(2,2,2-trifluoroacetyl)piperidin-3-yl]oxybenzeneamine oxide |
| SMILES | Cc1ccc([NH+]([O-])O)c(O[C@H]2CCCN(C(=O)C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C14H17F3N2O4/c1-9-4-5-11(19(21)22)12(7-9)23-10-3-2-6-18(8-10)13(20)14(15,16)17/h4-5,7,10,19,21H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | GJRSSVJEGOZGOT-JTQLQIEISA-N |
| XLogP | 1.33 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|