C17H24N2O5 — CID 174680638
[(3S)-3-(5-methyl-2-nitrophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174680638) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(3S)-3-(5-methyl-2-nitrophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-(5-methyl-2-nitrophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174680638 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(3S)-3-(5-methyl-2-nitrophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1ccc([N+](=O)[O-])c(O[C@H]2CCCN(OC(=O)C(C)(C)C)C2)c1 |
| InChI | InChI=1S/C17H24N2O5/c1-12-7-8-14(19(21)22)15(10-12)23-13-6-5-9-18(11-13)24-16(20)17(2,3)4/h7-8,10,13H,5-6,9,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | GUTGRYPBEYPTSM-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|