C17H25NO3 — CID 174977791
[4-(4-methylphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174977791) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [4-(4-methylphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-methylphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174977791 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [4-(4-methylphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(OC2CCN(OC(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-13-5-7-14(8-6-13)20-15-9-11-18(12-10-15)21-16(19)17(2,3)4/h5-8,15H,9-12H2,1-4H3 |
| InChIKey | ZJNZVOUECIYLAK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |