C21H29NO3 — CID 174492815
[4-[(E)-3-(3,5-dimethylphenyl)prop-2-enoyl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174492815) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [4-[(E)-3-(3,5-dimethylphenyl)prop-2-enoyl]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-3-(3,5-dimethylphenyl)prop-2-enoyl]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174492815 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [4-[(E)-3-(3,5-dimethylphenyl)prop-2-enoyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1cc(C)cc(/C=C/C(=O)C2CCN(OC(=O)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H29NO3/c1-15-12-16(2)14-17(13-15)6-7-19(23)18-8-10-22(11-9-18)25-20(24)21(3,4)5/h6-7,12-14,18H,8-11H2,1-5H3/b7-6+ |
| InChIKey | RNWZNPITCYURJE-VOTSOKGWSA-N |
| XLogP | 4.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|