C17H22FNO3 — CID 174578442
[4-(4-fluorobenzoyl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174578442) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-fluorobenzoyl)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174578442 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [4-(4-fluorobenzoyl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H22FNO3/c1-17(2,3)16(21)22-19-10-8-13(9-11-19)15(20)12-4-6-14(18)7-5-12/h4-7,13H,8-11H2,1-3H3 |
| InChIKey | BJMMFSFTXBOKAD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |